CAS 898760-40-2
:(3-chloro-4-fluoro-phenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone
Description:
The chemical substance known as (3-chloro-4-fluoro-phenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898760-40-2, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both chlorine and fluorine atoms, as well as a methanone functional group. The presence of the 1,3-dioxolane moiety indicates that it contains a five-membered cyclic ether, contributing to its potential reactivity and solubility properties. This compound may exhibit interesting biological activities due to its unique functional groups, making it a candidate for pharmaceutical applications. Its molecular structure suggests it could participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, depending on the conditions. Additionally, the presence of halogen substituents often influences the compound's lipophilicity and overall stability. As with many synthetic compounds, safety data and handling precautions should be observed, particularly due to the presence of halogens, which can pose health risks.
Formula:C16H12ClFO3
InChI:InChI=1/C16H12ClFO3/c17-13-9-12(5-6-14(13)18)15(19)10-1-3-11(4-2-10)16-20-7-8-21-16/h1-6,9,16H,7-8H2
SMILES:c1cc(ccc1C(=O)c1ccc(c(c1)Cl)F)C1OCCO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.