CAS 898760-42-4

1-Propanone, 3-(3-bromophenyl)-1-(3-chloro-4-fluorophenyl)-

Description:

1-Propanone, 3-(3-bromophenyl)-1-(3-chloro-4-fluorophenyl)-, also known by its CAS number 898760-42-4, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-bromophenyl group and a 3-chloro-4-fluorophenyl group. The presence of halogen atoms (bromine, chlorine, and fluorine) in the aromatic rings contributes to its chemical reactivity and potential biological activity. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic systems, which can influence its solubility in organic solvents. Additionally, the presence of multiple halogens may enhance its potential as a pharmacophore in medicinal chemistry, making it of interest in drug development. Its synthesis and handling would require standard laboratory safety protocols due to the presence of halogenated compounds, which can pose environmental and health risks.

Formula: C₁₅H₁₁BrClFO

InChI: InChI=1S/C15H11BrClFO/c16-12-3-1-2-10(8-12)4-7-15(19)11-5-6-14(18)13(17)9-11/h1-3,5-6,8-9H,4,7H2

InChI key: InChIKey=FVYYNBGXRAFGPU-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Br)=CC=C1)(=O)C2=CC(Cl)=C(F)C=C2

Synonyms:

• 3-(3-Bromophenyl)-1-(3-chloro-4-fluorophenyl)propan-1-one
• 3-(3-Bromophenyl)-3′-chloro-4′-fluoropropiophenone
• 1-Propanone, 3-(3-bromophenyl)-1-(3-chloro-4-fluorophenyl)-

3-(3-bromophenyl)-3′-chloro-4′-fluoropropiophenone

CAS: 898760-42-4

Formula: C₁₅H₁₁BrClFO

Purity: 97.0%

Molecular weight: 341.6

Ref: 10-F206070