CAS 898760-44-6
:(2,6-difluorophenyl)-oxazol-2-yl-methanone
Description:
(2,6-Difluorophenyl)-oxazol-2-yl-methanone is a chemical compound characterized by its unique structure, which includes a difluorophenyl group and an oxazole ring. The presence of fluorine atoms in the phenyl ring enhances its electronic properties, potentially increasing lipophilicity and influencing biological activity. The oxazole moiety contributes to the compound's stability and may participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. This compound is likely to exhibit specific reactivity patterns due to the functional groups present, making it of interest in medicinal chemistry and material science. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. Additionally, the compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of substituents. Overall, (2,6-difluorophenyl)-oxazol-2-yl-methanone represents a versatile scaffold for further chemical exploration and application in various fields.
Formula:C10H5F2NO2
InChI:InChI=1/C10H5F2NO2/c11-6-2-1-3-7(12)8(6)9(14)10-13-4-5-15-10/h1-5H
SMILES:c1cc(c(c(c1)F)C(=O)c1ncco1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.