CAS 898760-47-9
:(3,4-difluorophenyl)-oxazol-2-yl-methanone
Description:
(3,4-Difluorophenyl)-oxazol-2-yl-methanone is a chemical compound characterized by its unique structure, which includes a phenyl ring substituted with two fluorine atoms at the 3 and 4 positions, and an oxazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the oxazole moiety. The fluorine substituents can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its interaction with biological targets. The methanone functional group contributes to its reactivity, making it a candidate for various chemical reactions, including nucleophilic attacks. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing more complex molecules. As with many fluorinated compounds, it may also exhibit unique solubility and volatility characteristics, which can be important in applications ranging from pharmaceuticals to agrochemicals.
Formula:C10H5F2NO2
InChI:InChI=1/C10H5F2NO2/c11-7-2-1-6(5-8(7)12)9(14)10-13-3-4-15-10/h1-5H
SMILES:c1cc(c(cc1C(=O)c1ncco1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.