CAS 898760-50-4

(3,5-difluorophenyl)-oxazol-2-yl-methanone

Description:

(3,5-Difluorophenyl)-oxazol-2-yl-methanone is a chemical compound characterized by its unique structure, which includes a phenyl ring substituted with two fluorine atoms at the 3 and 5 positions, and an oxazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the oxazole moiety. The fluorine substituents can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. The methanone functional group contributes to its reactivity, making it a candidate for various chemical reactions, including nucleophilic attacks. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development or as a building block in organic synthesis. Its specific characteristics, such as solubility, melting point, and spectral properties, would depend on the conditions under which it is studied.

Formula: C₁₀H₅F₂NO₂

InChI: InChI=1/C10H5F2NO2/c11-7-3-6(4-8(12)5-7)9(14)10-13-1-2-15-10/h1-5H

SMILES: c1coc(C(=O)c2cc(cc(c2)F)F)n1

Synonyms:

• 2-(3,5-DIFLUOROBENZOYL)OXAZOLE
• Methanone, (3,5-difluorophenyl)-2-oxazolyl-
• (3,5-Difluorophenyl)(oxazol-2-yl)methanone