CAS 898760-51-5
:1-Propanone, 3-(3-bromophenyl)-1-[2-(trifluoromethyl)phenyl]-
Description:
1-Propanone, 3-(3-bromophenyl)-1-[2-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a bromophenyl group and a trifluoromethylphenyl group. The presence of the bromine atom introduces notable electrophilic properties, while the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and stability. The molecular structure suggests potential applications in pharmaceuticals and agrochemicals, where such substituents can modulate biological activity. Additionally, the compound's unique combination of functional groups may impart interesting physical properties, such as solubility and boiling point, which are influenced by the electron-withdrawing effects of the trifluoromethyl group and the steric hindrance from the bromophenyl moiety. Overall, this compound exemplifies the complexity and versatility of substituted ketones in organic chemistry.
Formula:C16H12BrF3O
InChI:InChI=1S/C16H12BrF3O/c17-12-5-3-4-11(10-12)8-9-15(21)13-6-1-2-7-14(13)16(18,19)20/h1-7,10H,8-9H2
InChI key:InChIKey=CYJJHEIZFPQWKK-UHFFFAOYSA-N
SMILES:C(CCC1=CC(Br)=CC=C1)(=O)C2=C(C(F)(F)F)C=CC=C2
Synonyms:- 3-(3-Bromophenyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one
- 3-(3-Bromophenyl)-2′-trifluoromethylpropiophenone
- 1-Propanone, 3-(3-bromophenyl)-1-[2-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.