CymitQuimica logo

CAS 898760-52-6

:

Methanone, [4-(1,3-dioxolan-2-yl)phenyl][3-(trifluoromethyl)phenyl]-

Description:
Methanone, [4-(1,3-dioxolan-2-yl)phenyl][3-(trifluoromethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. One of the rings features a 1,3-dioxolane substituent, contributing to its potential reactivity and solubility properties, while the other ring contains a trifluoromethyl group, which is known for enhancing the lipophilicity and biological activity of compounds. This compound is likely to exhibit unique chemical properties due to the presence of these functional groups, including potential applications in pharmaceuticals or agrochemicals. Its molecular structure suggests it may participate in various chemical reactions, such as electrophilic aromatic substitution or nucleophilic attacks, depending on the conditions. Additionally, the trifluoromethyl group can influence the compound's electronic properties, making it a subject of interest in medicinal chemistry. Overall, Methanone, [4-(1,3-dioxolan-2-yl)phenyl][3-(trifluoromethyl)phenyl]- represents a class of compounds that may have significant implications in synthetic organic chemistry and material science.
Formula:C17H13F3O3
InChI:InChI=1/C17H13F3O3/c18-17(19,20)14-3-1-2-13(10-14)15(21)11-4-6-12(7-5-11)16-22-8-9-23-16/h1-7,10,16H,8-9H2
InChI key:InChIKey=ANHOREKQZUJQPM-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C(F)(F)F)=CC=C1)C2=CC=C(C=C2)C3OCCO3
Synonyms:
  • 4′-(1,3-Dioxolan-2-yl)-3-trifluoromethylbenzophenone
  • Methanone, [4-(1,3-dioxolan-2-yl)phenyl][3-(trifluoromethyl)phenyl]-
  • [4-(1,3-Dioxolan-2-yl)phenyl][3-(trifluoromethyl)phenyl]methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.