CAS 898760-57-1

1-Propanone, 3-(3-bromophenyl)-1-[4-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(3-bromophenyl)-1-[4-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a bromophenyl group and a trifluoromethylphenyl group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity, while the trifluoromethyl group enhances its electron-withdrawing properties, potentially affecting its chemical behavior and interactions. The molecular structure suggests that it may exhibit significant lipophilicity due to the aromatic rings, which can impact its solubility in organic solvents. Additionally, the presence of multiple functional groups may allow for various chemical reactions, making it of interest in synthetic organic chemistry. Overall, this compound's unique combination of functional groups and substituents contributes to its potential applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and characterization.

Formula: C₁₆H₁₂BrF₃O

InChI: InChI=1S/C16H12BrF3O/c17-14-3-1-2-11(10-14)4-9-15(21)12-5-7-13(8-6-12)16(18,19)20/h1-3,5-8,10H,4,9H2

InChI key: InChIKey=YIRCCXRTFVWQHQ-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Br)=CC=C1)(=O)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 1-Propanone, 3-(3-bromophenyl)-1-[4-(trifluoromethyl)phenyl]-
• 3-(3-Bromophenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one
• 3-(3-Bromophenyl)-4′-trifluoromethylpropiophenone