CAS 898760-59-3

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(3-bromophenyl)-

Description:

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(3-bromophenyl)-, identified by its CAS number 898760-59-3, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-bromo-2-fluorophenyl group and a 3-bromophenyl group. The presence of bromine and fluorine atoms in the aromatic rings contributes to its unique chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The bromine atoms can enhance the compound's electrophilicity, while the fluorine atom may influence its lipophilicity and biological activity. Additionally, the compound's molecular structure suggests potential for interactions with biological targets, making it of interest for medicinal chemistry. Its physical properties, such as solubility and boiling point, would be influenced by the substituents and the overall molecular weight. As with many organic compounds, safety and handling precautions should be observed due to the presence of halogenated groups.

Formula: C₁₅H₁₁Br₂FO

InChI: InChI=1S/C15H11Br2FO/c16-11-3-1-2-10(8-11)4-7-15(19)13-6-5-12(17)9-14(13)18/h1-3,5-6,8-9H,4,7H2

InChI key: InChIKey=ZQWAFMXQHQEGQK-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Br)=CC=C1)(=O)C2=C(F)C=C(Br)C=C2

Synonyms:

• 1-(4-Bromo-2-fluorophenyl)-3-(3-bromophenyl)propan-1-one
• 4′-Bromo-3-(3-bromophenyl)-2′-fluoropropiophenone
• 1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(3-bromophenyl)-

4′-bromo-3-(3-bromophenyl)-2′-fluoropropiophenone

CAS: 898760-59-3

Formula: C₁₅H₁₁Br₂FO

Purity: 97.0%

Molecular weight: 386.058

Ref: 10-F206076