CAS 898760-68-4

(2,4-dichlorophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone

Description:

The chemical substance known as (2,4-dichlorophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898760-68-4, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a dioxolane moiety. This compound typically exhibits properties associated with aromatic ketones, such as stability and potential reactivity due to the presence of the carbonyl group. The dichlorophenyl substituent may impart specific electronic and steric effects, influencing its reactivity and interactions in chemical processes. The dioxolane ring contributes to the compound's solubility and may enhance its biological activity, making it of interest in pharmaceutical applications. Additionally, the presence of chlorine atoms can affect the compound's lipophilicity and overall pharmacokinetic properties. Overall, this compound's unique structural features suggest potential utility in various chemical and biological contexts, warranting further investigation into its properties and applications.

Formula: C₁₆H₁₂Cl₂O₃

InChI: InChI=1/C16H12Cl2O3/c17-12-5-6-13(14(18)9-12)15(19)10-1-3-11(4-2-10)16-20-7-8-21-16/h1-6,9,16H,7-8H2

SMILES: c1cc(ccc1C(=O)c1ccc(cc1Cl)Cl)C1OCCO1