CAS 898760-70-8

Methanone, (2,5-dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (2,5-dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 2,5-dichlorophenyl group indicates that chlorine atoms are substituted on the phenyl ring, which can influence the compound's reactivity and physical properties. Additionally, the compound features a 1,3-dioxolane moiety, a five-membered cyclic ether that contributes to its overall stability and solubility characteristics. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the electron-withdrawing nature of the chlorine substituents and the presence of the dioxolane ring, which can affect its lipophilicity and potential interactions with biological targets. Overall, this compound's unique structural attributes suggest potential applications in pharmaceuticals or agrochemicals, although specific biological or chemical properties would require further investigation.

Formula: C₁₆H₁₂Cl₂O₃

InChI: InChI=1S/C16H12Cl2O3/c17-12-5-6-14(18)13(9-12)15(19)10-1-3-11(4-2-10)16-20-7-8-21-16/h1-6,9,16H,7-8H2

InChI key: InChIKey=LHJVSKJZVBPFJJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=CC(Cl)=C1)C2=CC=C(C=C2)C3OCCO3

Synonyms:

• Methanone, (2,5-dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]-
• (2,5-Dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone

2,5-dichloro-4'-(1,3-dioxolan-2-yl)benzophenone

CAS: 898760-70-8

Purity: 97.0%

Molecular weight: 323.1700134277344

Ref: 10-F206885