CAS 898760-72-0

(3,4-Dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone

Description:

(3,4-Dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898760-72-0, is an organic compound characterized by its complex structure, which includes a dichlorophenyl group and a phenyl moiety linked to a dioxolane ring. This compound typically exhibits properties associated with aromatic ketones, such as stability and potential reactivity due to the presence of the carbonyl group. The dichlorophenyl substituent may impart specific electronic and steric effects, influencing its reactivity and interactions in chemical reactions. The dioxolane ring contributes to the compound's solubility and may affect its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of chlorine atoms can enhance lipophilicity and alter the compound's pharmacokinetic properties. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation through empirical studies.

Formula: C₁₆H₁₂Cl₂O₃

InChI: InChI=1S/C16H12Cl2O3/c17-13-6-5-12(9-14(13)18)15(19)10-1-3-11(4-2-10)16-20-7-8-21-16/h1-6,9,16H,7-8H2

InChI key: InChIKey=YMDGTRGDYWXHRO-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C=C1)C2OCCO2)C3=CC(Cl)=C(Cl)C=C3

Synonyms:

• (3,4-Dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone
• Methanone, (3,4-dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]-
• 3,4-Dichloro-4′-(1,3-dioxolan-2-yl)benzophenone