CymitQuimica logo

CAS 898760-74-2

:

(3,5-Dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone

Description:
(3,5-Dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone, identified by its CAS number 898760-74-2, is an organic compound characterized by its complex structure that includes a dichlorophenyl group and a dioxolane moiety. This compound typically exhibits properties associated with aromatic ketones, such as moderate to high stability under standard conditions and potential reactivity due to the presence of electrophilic sites. The dichlorophenyl group contributes to its lipophilicity, which may influence its solubility in organic solvents. The dioxolane ring can impart unique chemical reactivity, making it a potential candidate for various synthetic applications, including in medicinal chemistry. Additionally, the presence of chlorine substituents can enhance biological activity and influence pharmacokinetic properties. Overall, this compound's characteristics make it of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals. However, specific safety and handling guidelines should be followed due to the potential hazards associated with chlorinated compounds.
Formula:C16H12Cl2O3
InChI:InChI=1S/C16H12Cl2O3/c17-13-7-12(8-14(18)9-13)15(19)10-1-3-11(4-2-10)16-20-5-6-21-16/h1-4,7-9,16H,5-6H2
InChI key:InChIKey=SHVJBYNOXFBTAB-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=CC(Cl)=C1)C2=CC=C(C=C2)C3OCCO3
Synonyms:
  • (3,5-Dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone
  • Methanone, (3,5-dichlorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.