CAS 898760-80-0
:(3,5-Difluorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone
Description:
(3,5-Difluorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898760-80-0, is an organic compound characterized by its complex structure that includes a difluorophenyl group and a dioxolane moiety. This compound typically exhibits properties associated with aromatic ketones, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. The difluorophenyl substituent may influence its electronic properties, potentially enhancing its reactivity or stability in certain chemical environments. The dioxolane ring contributes to the compound's overall polarity and may affect its interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the presence of fluorine atoms can enhance lipophilicity and alter the compound's pharmacokinetic properties. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C16H12F2O3
InChI:InChI=1/C16H12F2O3/c17-13-7-12(8-14(18)9-13)15(19)10-1-3-11(4-2-10)16-20-5-6-21-16/h1-4,7-9,16H,5-6H2
InChI key:InChIKey=FWDIRAWQEWAMLH-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=CC(F)=C1)C2=CC=C(C=C2)C3OCCO3
Synonyms:- Methanone, (3,5-difluorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]-
- (3,5-Difluorophenyl)[4-(1,3-dioxolan-2-yl)phenyl]methanone
- 3,5-Difluoro-4′-(1,3-dioxolan-2-yl)benzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.