CAS 898760-82-2

[4-(1,3-dioxolan-2-yl)phenyl]-(3,4,5-trifluorophenyl)methanone

Description:

The chemical substance known as [4-(1,3-dioxolan-2-yl)phenyl]-(3,4,5-trifluorophenyl)methanone, with the CAS number 898760-82-2, is characterized by its complex molecular structure, which includes a phenyl ring substituted with a dioxolane moiety and a trifluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential stability and reactivity due to the presence of the dioxolane ring. The trifluoromethyl groups contribute to its lipophilicity and may enhance its biological activity, making it of interest in pharmaceutical applications. The presence of fluorine atoms can also influence the compound's electronic properties, potentially affecting its interaction with biological targets. Additionally, the compound may exhibit specific solubility characteristics in organic solvents, which is important for its application in synthesis and formulation. Overall, this substance represents a unique combination of functional groups that may impart distinctive chemical behavior and potential utility in various chemical and medicinal contexts.

Formula: C₁₆H₁₁F₃O₃

InChI: InChI=1/C16H11F3O3/c17-12-7-11(8-13(18)14(12)19)15(20)9-1-3-10(4-2-9)16-21-5-6-22-16/h1-4,7-8,16H,5-6H2

InChI key: InChIKey=MGFAKKRCJUJNQC-UHFFFAOYSA-N

SMILES: c1cc(ccc1C(=O)c1cc(c(c(c1)F)F)F)C1OCCO1