CAS 898760-84-4

Cyclopropyl[4-(1,3-dioxolan-2-yl)phenyl]methanone

Description:

Cyclopropyl[4-(1,3-dioxolan-2-yl)phenyl]methanone is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a phenyl ring substituted with a 1,3-dioxolane moiety. This compound typically exhibits properties associated with both cyclic and aromatic systems, such as stability and potential reactivity due to the presence of the carbonyl group in the ketone functional group. The dioxolane ring contributes to its polar characteristics, which can influence solubility and reactivity in various chemical environments. Cyclopropyl groups are known for their strain, which can lead to interesting reactivity patterns in organic synthesis. The compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and unique structural features. Its synthesis and reactivity can be explored in the context of developing new pharmaceuticals or functional materials. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.

Formula: C₁₃H₁₄O₃

InChI: InChI=1S/C13H14O3/c14-12(9-1-2-9)10-3-5-11(6-4-10)13-15-7-8-16-13/h3-6,9,13H,1-2,7-8H2

InChI key: InChIKey=KJOJOJACFMQMRT-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C=C1)C2OCCO2)C3CC3

Synonyms:

• Methanone, cyclopropyl[4-(1,3-dioxolan-2-yl)phenyl]-
• Cyclopropyl[4-(1,3-dioxolan-2-yl)phenyl]methanone