CAS 898760-88-8
:Cyclopentyl[4-(1,3-dioxolan-2-yl)phenyl]methanone
Description:
Cyclopentyl[4-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898760-88-8, is an organic compound characterized by its unique structure that includes a cyclopentyl group and a phenyl ring substituted with a 1,3-dioxolane moiety. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It may have moderate solubility in organic solvents, reflecting its hydrophobic cyclopentyl and phenyl components, while the dioxolane ring can impart some polar characteristics. The presence of the dioxolane group suggests potential reactivity in various chemical transformations, making it of interest in synthetic organic chemistry. Additionally, compounds like this may exhibit biological activity, which could be relevant in pharmaceutical applications. However, specific reactivity, stability, and biological properties would require further investigation through empirical studies. Safety data should also be consulted to ensure proper handling and usage in laboratory settings.
Formula:C15H18O3
InChI:InChI=1S/C15H18O3/c16-14(11-3-1-2-4-11)12-5-7-13(8-6-12)15-17-9-10-18-15/h5-8,11,15H,1-4,9-10H2
InChI key:InChIKey=BWTSBMHNLIOJAL-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(C=C1)C2OCCO2)C3CCCC3
Synonyms:- Methanone, cyclopentyl[4-(1,3-dioxolan-2-yl)phenyl]-
- Cyclopentyl[4-(1,3-dioxolan-2-yl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.