CAS 898760-90-2

Cyclohexyl[4-(1,3-dioxolan-2-yl)phenyl]methanone

Description:

Cyclohexyl[4-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898760-90-2, is an organic compound characterized by its unique structure that includes a cyclohexyl group and a phenyl ring substituted with a 1,3-dioxolane moiety. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic cyclohexyl and phenyl components. The presence of the dioxolane ring may impart some degree of polarity and influence its reactivity, making it potentially useful in various chemical reactions, including those in organic synthesis and material science. Additionally, its structural features suggest potential applications in pharmaceuticals or as an intermediate in the synthesis of more complex molecules. However, specific safety and handling guidelines should be followed, as with any chemical substance.

Formula: C₁₆H₂₀O₃

InChI: InChI=1S/C16H20O3/c17-15(12-4-2-1-3-5-12)13-6-8-14(9-7-13)16-18-10-11-19-16/h6-9,12,16H,1-5,10-11H2

InChI key: InChIKey=PYQDNHLDDMGTIK-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C=C1)C2OCCO2)C3CCCCC3

Synonyms:

• Cyclohexyl[4-(1,3-dioxolan-2-yl)phenyl]methanone
• Methanone, cyclohexyl[4-(1,3-dioxolan-2-yl)phenyl]-