CAS 898760-96-8

1-(4-bromo-3-methyl-phenyl)-6-chloro-hexan-1-one

Description:

1-(4-bromo-3-methyl-phenyl)-6-chloro-hexan-1-one, with the CAS number 898760-96-8, is an organic compound characterized by its complex structure, which includes a hexanone backbone substituted with both bromine and chlorine atoms. The presence of the bromo and chloro substituents indicates that this compound may exhibit unique reactivity and properties compared to its unsubstituted analogs. Typically, such halogenated compounds can participate in nucleophilic substitution reactions and may also exhibit varying degrees of lipophilicity due to the halogen atoms. The methyl group on the phenyl ring can influence the electronic properties of the molecule, potentially affecting its reactivity and interactions with biological systems. Additionally, the compound's ketone functional group suggests it may engage in typical carbonyl chemistry, such as condensation reactions. Overall, the presence of multiple functional groups and substituents in this compound suggests a diverse range of potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₃H₁₆BrClO

InChI: InChI=1/C13H16BrClO/c1-10-9-11(6-7-12(10)14)13(16)5-3-2-4-8-15/h6-7,9H,2-5,8H2,1H3

SMILES: Cc1cc(ccc1Br)C(=O)CCCCCCl