CAS 898760-97-9

1-Propanone, 3-(4-bromophenyl)-1-(3-methylphenyl)-

Description:

1-Propanone, 3-(4-bromophenyl)-1-(3-methylphenyl)-, also known by its CAS number 898760-97-9, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-bromophenyl group and a 3-methylphenyl group. The presence of the bromine atom introduces notable electronegative characteristics, potentially influencing the compound's reactivity and physical properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic content, which can affect their solubility in various solvents. The molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of multiple functional groups may allow for further chemical modifications, making it a versatile intermediate in synthetic chemistry. As with many organic compounds, safety data should be consulted for handling and usage, as the presence of bromine can pose specific health and environmental risks.

Formula: C₁₆H₁₅BrO

InChI: InChI=1S/C16H15BrO/c1-12-3-2-4-14(11-12)16(18)10-7-13-5-8-15(17)9-6-13/h2-6,8-9,11H,7,10H2,1H3

InChI key: InChIKey=LCAWQJJZSKXOJB-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Br)C=C1)(=O)C2=CC(C)=CC=C2

Synonyms:

• 1-Propanone, 3-(4-bromophenyl)-1-(3-methylphenyl)-
• 3-(4-Bromophenyl)-1-(3-methylphenyl)propan-1-one
• 3-(4-Bromophenyl)-3′-methylpropiophenone