CAS 898760-98-0
:1-(4-Bromo-3-methylphenyl)-7-chloro-1-heptanone
Description:
1-(4-Bromo-3-methylphenyl)-7-chloro-1-heptanone, with the CAS number 898760-98-0, is an organic compound characterized by its complex structure, which includes a heptanone backbone substituted with both a bromo and a chloro group. The presence of the bromo and chloro substituents indicates that this compound may exhibit unique reactivity and properties compared to its unsubstituted counterparts. Typically, compounds like this can be used in various applications, including pharmaceuticals and agrochemicals, due to their potential biological activity. The molecular structure suggests that it may possess hydrophobic characteristics, which can influence its solubility and interaction with biological membranes. Additionally, the presence of the ketone functional group indicates that it may participate in various chemical reactions, such as nucleophilic additions. Overall, this compound's specific characteristics, including its melting point, boiling point, and reactivity, would be determined through experimental data and further analysis.
Formula:C14H18BrClO
InChI:InChI=1S/C14H18BrClO/c1-11-10-12(7-8-13(11)15)14(17)6-4-2-3-5-9-16/h7-8,10H,2-6,9H2,1H3
InChI key:InChIKey=IWCLULULOUMDNH-UHFFFAOYSA-N
SMILES:C(CCCCCCCl)(=O)C1=CC(C)=C(Br)C=C1
Synonyms:- 1-(4-Bromo-3-methylphenyl)-7-chloro-1-heptanone
- 1-Heptanone, 1-(4-bromo-3-methylphenyl)-7-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.