CAS 898761-00-7

6-Chloro-1-(3,4-dichlorophenyl)-1-hexanone

Description:

6-Chloro-1-(3,4-dichlorophenyl)-1-hexanone, with the CAS number 898761-00-7, is an organic compound characterized by its unique structure, which includes a hexanone backbone substituted with a chloro group and a dichlorophenyl moiety. This compound typically exhibits a moderate to high level of lipophilicity due to the presence of the aromatic ring and halogen substituents, which can influence its solubility in organic solvents. The chloro and dichloro groups can also impart specific reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. In terms of physical properties, it may present as a solid or liquid at room temperature, depending on its specific formulation and purity. The compound's biological activity and potential applications can vary, often being explored in fields such as medicinal chemistry or agrochemicals. Safety and handling precautions are essential, as halogenated compounds can pose environmental and health risks. Always refer to safety data sheets and regulatory guidelines when working with such substances.

Formula: C₁₂H₁₃Cl₃O

InChI: InChI=1S/C12H13Cl3O/c13-7-3-1-2-4-12(16)9-5-6-10(14)11(15)8-9/h5-6,8H,1-4,7H2

InChI key: InChIKey=MQONOWOIXRTQBW-UHFFFAOYSA-N

SMILES: C(CCCCCCl)(=O)C1=CC(Cl)=C(Cl)C=C1

Synonyms:

• 6-Chloro-1-(3,4-dichlorophenyl)-1-hexanone
• 1-Hexanone, 6-chloro-1-(3,4-dichlorophenyl)-

6-chloro-1-(3,4-dichlorophenyl)-1-oxohexane

CAS: 898761-00-7

Formula: C₁₂H₁₃Cl₃O

Purity: 97.0%

Molecular weight: 279.59

Ref: 10-F206903