CAS 898761-10-9

7-Chloro-1-(4-fluoro-3-methylphenyl)-1-heptanone

Description:

7-Chloro-1-(4-fluoro-3-methylphenyl)-1-heptanone is an organic compound characterized by its ketone functional group and a complex aromatic structure. The presence of a chlorine atom and a fluorine atom in its molecular structure contributes to its unique chemical properties, including potential reactivity and polarity. The compound features a heptanone backbone, indicating a seven-carbon chain with a ketone functional group at one end, while the aromatic ring, substituted with a fluorine and a methyl group, enhances its hydrophobic characteristics. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests that it could participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, due to the presence of electron-withdrawing groups. Additionally, the compound's solubility and stability can be influenced by the substituents on the aromatic ring and the length of the aliphatic chain. Overall, 7-Chloro-1-(4-fluoro-3-methylphenyl)-1-heptanone represents a versatile structure in organic chemistry with potential applications in various fields.

Formula: C₁₄H₁₈ClFO

InChI: InChI=1S/C14H18ClFO/c1-11-10-12(7-8-13(11)16)14(17)6-4-2-3-5-9-15/h7-8,10H,2-6,9H2,1H3

InChI key: InChIKey=XOKAZFAUZONDJP-UHFFFAOYSA-N

SMILES: C(CCCCCCCl)(=O)C1=CC(C)=C(F)C=C1

Synonyms:

• 7-Chloro-1-(4-fluoro-3-methylphenyl)-1-heptanone
• 1-Heptanone, 7-chloro-1-(4-fluoro-3-methylphenyl)-

7-chloro-1-(4-fluoro-3-methylphenyl)-1-oxoheptane

CAS: 898761-10-9

Formula: C₁₄H₁₈ClFO

Purity: 97.0%

Molecular weight: 256.75

Ref: 10-F206908