CymitQuimica logo

CAS 898761-20-1

:

1-[3-(1-Azetidinylmethyl)phenyl]-1,8-undecanedione

Description:
1-[3-(1-Azetidinylmethyl)phenyl]-1,8-undecanedione, with the CAS number 898761-20-1, is a synthetic organic compound characterized by its unique structure that includes an azetidine ring and a long aliphatic chain. This compound features a phenyl group attached to a carbon chain that connects to a diketone functional group, which is indicative of its potential reactivity and biological activity. The presence of the azetidine moiety suggests that it may exhibit interesting pharmacological properties, as azetidines are often found in various bioactive compounds. The long aliphatic chain may influence its solubility and lipophilicity, affecting its interaction with biological membranes. Additionally, the diketone functionality can participate in various chemical reactions, including condensation and oxidation, making it a versatile building block in organic synthesis. Overall, this compound's structural characteristics suggest potential applications in medicinal chemistry and materials science, although specific biological activities and applications would require further investigation.
Formula:C21H31NO2
InChI:InChI=1S/C21H31NO2/c1-2-9-20(23)12-5-3-4-6-13-21(24)19-11-7-10-18(16-19)17-22-14-8-15-22/h7,10-11,16H,2-6,8-9,12-15,17H2,1H3
InChI key:InChIKey=MHEUUJQAKAUMFC-UHFFFAOYSA-N
SMILES:C(C1=CC(C(CCCCCCC(CCC)=O)=O)=CC=C1)N2CCC2
Synonyms:
  • 1-[3-(1-Azetidinylmethyl)phenyl]-1,8-undecanedione
  • 1,8-Undecanedione, 1-[3-(1-azetidinylmethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.