CymitQuimica logo

CAS 898761-30-3

:

6-chloro-1-(3-fluoro-4-methyl-phenyl)hexan-1-one

Description:
6-Chloro-1-(3-fluoro-4-methyl-phenyl)hexan-1-one is an organic compound characterized by its unique structure, which includes a hexanone backbone substituted with a chloro group and a phenyl ring that carries both a fluorine and a methyl group. This compound typically exhibits properties common to ketones, such as being a polar molecule due to the carbonyl group, which can engage in hydrogen bonding with solvents. The presence of the chloro and fluoro substituents can influence its reactivity and solubility, potentially enhancing its lipophilicity and altering its electronic properties. The compound may be utilized in various chemical syntheses or as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the overall molecular weight. As with many halogenated compounds, it may also exhibit unique biological activities, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the presence of halogen atoms, which can impart toxicity.
Formula:C13H16ClFO
InChI:InChI=1/C13H16ClFO/c1-10-6-7-11(9-12(10)15)13(16)5-3-2-4-8-14/h6-7,9H,2-5,8H2,1H3
SMILES:Cc1ccc(cc1F)C(=O)CCCCCCl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.