CymitQuimica logo

CAS 898761-39-2

:

5-chloro-1-[2-(trifluoromethoxy)phenyl]pentan-1-one

Description:
5-Chloro-1-[2-(trifluoromethoxy)phenyl]pentan-1-one is an organic compound characterized by its complex structure, which includes a pentanone backbone, a chloro substituent, and a trifluoromethoxy group attached to a phenyl ring. The presence of the chloro group introduces a halogen, which can influence the compound's reactivity and polarity. The trifluoromethoxy group contributes significant electronegativity due to the fluorine atoms, enhancing the compound's lipophilicity and potentially affecting its biological activity. This compound is likely to exhibit properties typical of ketones, such as being a polar solvent and participating in nucleophilic addition reactions. Its unique functional groups may also impart specific characteristics, such as increased stability or reactivity under certain conditions. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups are often associated with bioactivity. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C12H12ClF3O2
InChI:InChI=1/C12H12ClF3O2/c13-8-4-3-6-10(17)9-5-1-2-7-11(9)18-12(14,15)16/h1-2,5,7H,3-4,6,8H2
SMILES:c1ccc(c(c1)C(=O)CCCCCl)OC(F)(F)F
Synonyms:
  • 5-CHLORO-1-(2-TRIFLUOROMETHOXYPHENYL)-1-OXOPENTANE
  • 1-Pentanone, 5-chloro-1-[2-(trifluoromethoxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.