CAS 898761-45-0
:7-chloro-1-[2-(trifluoromethoxy)phenyl]heptan-1-one
Description:
7-Chloro-1-[2-(trifluoromethoxy)phenyl]heptan-1-one is a synthetic organic compound characterized by its complex structure, which includes a heptanone backbone, a chloro substituent, and a trifluoromethoxy group attached to a phenyl ring. This compound typically exhibits properties associated with halogenated organic molecules, such as increased lipophilicity and potential bioactivity. The presence of the trifluoromethoxy group can enhance the compound's stability and influence its reactivity, making it of interest in medicinal chemistry and material science. The chloro group may also contribute to the compound's pharmacological properties, potentially affecting its interaction with biological targets. Additionally, the heptanone structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and reductions. Overall, this compound's unique functional groups and structural features make it a candidate for further research in drug development and other applications in organic synthesis.
Formula:C14H16ClF3O2
InChI:InChI=1/C14H16ClF3O2/c15-10-6-2-1-3-8-12(19)11-7-4-5-9-13(11)20-14(16,17)18/h4-5,7,9H,1-3,6,8,10H2
SMILES:C(CCCCl)CCC(=O)c1ccccc1OC(F)(F)F
Synonyms:- 7-CHLORO-1-(2-TRIFLUOROMETHOXYPHENYL)-1-OXOHEPTANE
- 1-Heptanone, 7-chloro-1-[2-(trifluoromethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.