CAS 898761-51-8
:5-chloro-1-(3,4-difluorophenyl)pentan-1-one
Description:
5-Chloro-1-(3,4-difluorophenyl)pentan-1-one is an organic compound characterized by its ketone functional group and the presence of chlorine and fluorine substituents on its aromatic ring. The molecular structure features a pentanone backbone, indicating a five-carbon chain with a carbonyl group (C=O) at one end. The presence of the 3,4-difluorophenyl group introduces significant electronegativity due to the fluorine atoms, which can influence the compound's reactivity and polarity. The chlorine atom adds further complexity to the compound's chemical behavior, potentially affecting its solubility and interaction with other molecules. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its unique combination of halogen substituents can also impact its stability and reactivity in various chemical reactions. Overall, 5-chloro-1-(3,4-difluorophenyl)pentan-1-one is a notable compound in organic chemistry, with potential applications in medicinal chemistry and material science.
Formula:C11H11ClF2O
InChI:InChI=1/C11H11ClF2O/c12-6-2-1-3-11(15)8-4-5-9(13)10(14)7-8/h4-5,7H,1-3,6H2
SMILES:C(CCCl)CC(=O)c1ccc(c(c1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.