CAS 898761-52-9
:1-Propanone, 3-(4-bromophenyl)-1-(2,6-dimethylphenyl)-
Description:
1-Propanone, 3-(4-bromophenyl)-1-(2,6-dimethylphenyl)-, also known by its CAS number 898761-52-9, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-bromophenyl group and a 2,6-dimethylphenyl group. The presence of the bromine atom introduces notable electronegative characteristics, potentially influencing the compound's reactivity and polarity. The dimethyl groups on the phenyl ring contribute to steric hindrance, which may affect the compound's interactions in chemical reactions. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have varying degrees of stability depending on environmental conditions. The presence of multiple aromatic rings suggests potential applications in materials science or pharmaceuticals, where such structures can exhibit unique electronic properties. Overall, the compound's characteristics are defined by its functional groups, molecular structure, and substituents, which collectively influence its chemical behavior and potential applications.
Formula:C17H17BrO
InChI:InChI=1S/C17H17BrO/c1-12-4-3-5-13(2)17(12)16(19)11-8-14-6-9-15(18)10-7-14/h3-7,9-10H,8,11H2,1-2H3
InChI key:InChIKey=SSNGFXWZOZWNLG-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(Br)C=C1)(=O)C2=C(C)C=CC=C2C
Synonyms:- 3-(4-Bromophenyl)-2′,6′-dimethylpropiophenone
- 1-Propanone, 3-(4-bromophenyl)-1-(2,6-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.