CAS 898761-55-2

1-Propanone, 3-(4-bromophenyl)-1-(3,4-dimethylphenyl)-

Description:

1-Propanone, 3-(4-bromophenyl)-1-(3,4-dimethylphenyl)-, also known by its CAS number 898761-55-2, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-bromophenyl group and a 3,4-dimethylphenyl group. The presence of the bromine atom introduces notable electrophilic properties, while the dimethyl groups can influence the compound's steric and electronic characteristics. Typically, such compounds exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their solubility in various solvents. The compound may also demonstrate interesting reactivity patterns in organic synthesis, particularly in electrophilic aromatic substitution reactions. Additionally, its structural complexity suggests potential applications in pharmaceuticals or materials science, although specific applications would depend on further research into its biological activity and physical properties. Overall, this compound exemplifies the diverse chemistry associated with substituted ketones and their derivatives.

Formula: C₁₇H₁₇BrO

InChI: InChI=1S/C17H17BrO/c1-12-3-7-15(11-13(12)2)17(19)10-6-14-4-8-16(18)9-5-14/h3-5,7-9,11H,6,10H2,1-2H3

InChI key: InChIKey=MLNOIROVDWCITO-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Br)C=C1)(=O)C2=CC(C)=C(C)C=C2

Synonyms:

• 3-(4-Bromophenyl)-3′,4′-dimethylpropiophenone
• 3-(4-Bromophenyl)-1-(3,4-dimethylphenyl)propan-1-one
• 1-Propanone, 3-(4-bromophenyl)-1-(3,4-dimethylphenyl)-