CAS 898761-60-9
:4-Chloro-1-[4-(trifluoromethoxy)phenyl]-1-butanone
Description:
4-Chloro-1-[4-(trifluoromethoxy)phenyl]-1-butanone, with the CAS number 898761-60-9, is an organic compound characterized by its complex structure that includes a butanone backbone substituted with a chloro group and a trifluoromethoxy group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity. Additionally, the chloro substituent can affect the compound's reactivity and stability. As with many halogenated compounds, it may exhibit specific environmental and health considerations, necessitating careful handling and disposal. Overall, 4-Chloro-1-[4-(trifluoromethoxy)phenyl]-1-butanone is a notable compound in the field of organic synthesis and drug development.
Formula:C11H10ClF3O2
InChI:InChI=1/C11H10ClF3O2/c12-7-1-2-10(16)8-3-5-9(6-4-8)17-11(13,14)15/h3-6H,1-2,7H2
InChI key:InChIKey=MANSZPOCYKRNLJ-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC=C(C(CCCCl)=O)C=C1
Synonyms:- 1-Butanone, 4-chloro-1-[4-(trifluoromethoxy)phenyl]-
- 4-Chloro-1-[4-(trifluoromethoxy)phenyl]-1-butanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.