CAS 898761-63-2

5-chloro-1-[4-(trifluoromethoxy)phenyl]pentan-1-one

Description:

5-Chloro-1-[4-(trifluoromethoxy)phenyl]pentan-1-one is an organic compound characterized by its complex structure, which includes a pentanone backbone substituted with a chloro group and a phenyl ring that carries a trifluoromethoxy group. The presence of the chloro substituent introduces a halogen, which can influence the compound's reactivity and polarity. The trifluoromethoxy group, consisting of a methoxy group with three fluorine atoms, enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry. This compound may exhibit unique properties such as increased stability and altered solubility due to the electron-withdrawing nature of the trifluoromethoxy group. Additionally, the presence of both halogen and trifluoromethoxy functionalities suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can enhance efficacy or selectivity. Overall, the compound's characteristics make it a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₂H₁₂ClF₃O₂

InChI: InChI=1/C12H12ClF3O2/c13-8-2-1-3-11(17)9-4-6-10(7-5-9)18-12(14,15)16/h4-7H,1-3,8H2

SMILES: C(CCCl)CC(=O)c1ccc(cc1)OC(F)(F)F

Synonyms:

• 1-Pentanone, 5-chloro-1-[4-(trifluoromethoxy)phenyl]-
• 5-CHLORO-1-OXO-1-(4-TRIFLUOROMETHOXYPHENYL)PENTANE
• 5-Chloro-1-[4-(trifluoromethoxy)phenyl]-1-pentanone