CAS 898761-71-2
:Methanone, (4-bromophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
Description:
Methanone, (4-bromophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, including a methanone functional group and a spirocyclic structure. The presence of a bromine atom on the phenyl ring contributes to its reactivity and potential applications in medicinal chemistry. The compound also contains a dioxane moiety, which may enhance solubility and stability. Its spirocyclic framework suggests potential for interesting conformational properties, which can influence biological activity. The compound's molecular structure indicates it may exhibit specific interactions with biological targets, making it a candidate for further investigation in drug development. Additionally, the presence of multiple aromatic rings may contribute to its electronic properties, potentially affecting its absorption and emission characteristics. Overall, this compound's intricate structure and functional groups suggest a range of possible applications in pharmaceuticals and materials science, warranting further study to elucidate its properties and potential uses.
Formula:C21H22BrNO3
InChI:InChI=1S/C21H22BrNO3/c22-19-6-4-17(5-7-19)20(24)18-3-1-2-16(14-18)15-23-10-8-21(9-11-23)25-12-13-26-21/h1-7,14H,8-13,15H2
InChI key:InChIKey=NCZVPKGJVGIRRE-UHFFFAOYSA-N
SMILES:C(N1CCC2(CC1)OCCO2)C3=CC(C(=O)C4=CC=C(Br)C=C4)=CC=C3
Synonyms:- Methanone, (4-bromophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
- (4-Bromophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.