CAS 898761-74-5

1-Propanone, 3-(4-bromophenyl)-1-[3-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(4-bromophenyl)-1-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-bromophenyl group and a 3-(trifluoromethyl)phenyl group. The presence of the bromine atom and trifluoromethyl group introduces significant electronegative characteristics, influencing the compound's reactivity and polarity. Typically, such compounds exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their solubility in various solvents. The trifluoromethyl group is known to enhance biological activity and stability, making this compound of interest in pharmaceutical and agrochemical research. Additionally, the presence of halogens can impart unique properties, such as increased resistance to metabolic degradation. Overall, this compound's structural features suggest potential applications in various fields, including medicinal chemistry and materials science, although specific applications would depend on further empirical studies.

Formula: C₁₆H₁₂BrF₃O

InChI: InChI=1S/C16H12BrF3O/c17-14-7-4-11(5-8-14)6-9-15(21)12-2-1-3-13(10-12)16(18,19)20/h1-5,7-8,10H,6,9H2

InChI key: InChIKey=MGLTXZXDLOFNOW-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Br)C=C1)(=O)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 1-Propanone, 3-(4-bromophenyl)-1-[3-(trifluoromethyl)phenyl]-
• 3-(4-Bromophenyl)-3′-trifluoromethylpropiophenone

3-(4-bromophenyl)-3′-trifluoromethylpropiophenone

CAS: 898761-74-5

Formula: C₁₆H₁₂BrF₃O

Purity: 97.0%

Molecular weight: 357.17

Ref: 10-F206127