CAS 898761-82-5

1-Propanone, 3-(4-bromophenyl)-1-(3-chloro-5-fluorophenyl)-

Description:

1-Propanone, 3-(4-bromophenyl)-1-(3-chloro-5-fluorophenyl)-, also known by its CAS number 898761-82-5, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-bromophenyl group and a 3-chloro-5-fluorophenyl group. The presence of halogen atoms (bromine, chlorine, and fluorine) in its structure contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The molecular structure suggests that it may exhibit interesting electronic properties due to the electron-withdrawing effects of the halogens, which can influence its reactivity and interactions with biological targets. Additionally, the compound's physical properties, such as solubility and boiling point, would be influenced by the presence of these substituents. Overall, this compound represents a class of substituted ketones that may have significant utility in synthetic organic chemistry.

Formula: C₁₅H₁₁BrClFO

InChI: InChI=1S/C15H11BrClFO/c16-12-4-1-10(2-5-12)3-6-15(19)11-7-13(17)9-14(18)8-11/h1-2,4-5,7-9H,3,6H2

InChI key: InChIKey=MJHRZLHPFGVHDG-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Br)C=C1)(=O)C2=CC(Cl)=CC(F)=C2

Synonyms:

• 1-Propanone, 3-(4-bromophenyl)-1-(3-chloro-5-fluorophenyl)-
• 3-(4-Bromophenyl)-1-(3-chloro-5-fluorophenyl)propan-1-one
• 3-(4-Bromophenyl)-3′-chloro-5′-fluoropropiophenone

3-(4-bromophenyl)-3′-chloro-5′-fluoropropiophenone

CAS: 898761-82-5

Formula: C₁₅H₁₁BrClFO

Purity: 97.0%

Molecular weight: 341.6

Ref: 10-F206131