![(4-bromo-3-fluoro-phenyl)-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F430608-4-bromo-3-fluoro-phenyl-3-14-dioxa-8-azaspiro-4-5-decan-8-ylmethyl-phenyl-methanone.webp&w=3840&q=75)
CAS 898761-93-8
:(4-bromo-3-fluoro-phenyl)-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (4-bromo-3-fluoro-phenyl)-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone, with the CAS number 898761-93-8, is a complex organic compound characterized by its unique structural features. It contains a phenyl ring substituted with bromine and fluorine atoms, which can influence its reactivity and biological activity. The presence of a spirocyclic structure, specifically the 1,4-dioxa-8-azaspiro[4.5]decan moiety, suggests potential applications in medicinal chemistry, particularly in drug design, due to its ability to interact with biological targets. The methanone functional group indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Overall, this compound's intricate structure and functional groups may contribute to its properties, including solubility, stability, and potential pharmacological effects, making it a subject of interest in research and development within the fields of organic and medicinal chemistry.
Formula:C21H21BrFNO3
InChI:InChI=1/C21H21BrFNO3/c22-18-5-4-17(13-19(18)23)20(25)16-3-1-2-15(12-16)14-24-8-6-21(7-9-24)26-10-11-27-21/h1-5,12-13H,6-11,14H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(c(c1)F)Br)CN1CCC2(CC1)OCCO2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.