CAS 898761-97-2

Methanone, (3-chloro-4-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (3-chloro-4-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and a spirocyclic moiety. The presence of chlorine and fluorine substituents on the phenyl rings contributes to its chemical reactivity and potential biological activity. The compound features a dioxa-azaspiro structure, indicating the presence of both oxygen and nitrogen atoms in a spirocyclic arrangement, which can influence its pharmacological properties. This compound may exhibit interesting interactions due to its diverse functional groups, making it a candidate for research in medicinal chemistry. Its CAS number, 898761-97-2, allows for easy identification in chemical databases. As with many synthetic organic compounds, its solubility, stability, and reactivity will depend on the specific conditions, including solvent choice and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₂₁H₂₁ClFNO₃

InChI: InChI=1S/C21H21ClFNO3/c22-18-13-17(4-5-19(18)23)20(25)16-3-1-2-15(12-16)14-24-8-6-21(7-9-24)26-10-11-27-21/h1-5,12-13H,6-11,14H2

InChI key: InChIKey=HHFMWVIRDILBNT-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC(C(=O)C4=CC(Cl)=C(F)C=C4)=CC=C3

Synonyms:

• (3-Chloro-4-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
• Methanone, (3-chloro-4-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

3-chloro-3′-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]-4-fluorobenzophenone

CAS: 898761-97-2

Formula: C₂₁H₂₁ClFNO₃

Purity: 97.0%

Molecular weight: 389.85

Ref: 10-F204912