CymitQuimica logo

CAS 898762-07-7

:

[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone

Description:
The chemical substance known as [3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone, with the CAS number 898762-07-7, is characterized by its complex molecular structure, which includes a spirocyclic moiety and a trifluoromethyl group. This compound features a phenyl ring substituted with a trifluoromethyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the 1,4-dioxa and azaspiro components suggests that it may exhibit unique chemical properties, such as increased stability or specific reactivity patterns. The methanone functional group indicates that it is a ketone, which can participate in various chemical reactions, including nucleophilic additions. Overall, this compound's structural features may contribute to its potential applications in medicinal chemistry or material science, although specific biological or physical properties would require further investigation through experimental studies.
Formula:C22H22F3NO3
InChI:InChI=1/C22H22F3NO3/c23-22(24,25)19-6-4-17(5-7-19)20(27)18-3-1-2-16(14-18)15-26-10-8-21(9-11-26)28-12-13-29-21/h1-7,14H,8-13,15H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(cc1)C(F)(F)F)CN1CCC2(CC1)OCCO2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.