CAS 898762-09-9
:Methanone, (4-bromo-2-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
Description:
Methanone, (4-bromo-2-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, including a methanone functional group and a spirocyclic structure. The presence of bromine and fluorine substituents on the phenyl rings contributes to its chemical reactivity and potential biological activity. The compound contains a dioxa-azaspiro moiety, which may influence its pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. The compound's solubility, stability, and reactivity can vary based on its substituents and the overall molecular architecture. As with many organic compounds, safety and handling precautions are essential, particularly due to the presence of halogenated groups, which can pose environmental and health risks. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C21H21BrFNO3
InChI:InChI=1S/C21H21BrFNO3/c22-17-4-5-18(19(23)13-17)20(25)16-3-1-2-15(12-16)14-24-8-6-21(7-9-24)26-10-11-27-21/h1-5,12-13H,6-11,14H2
InChI key:InChIKey=RHCHXOUDQIMVSM-UHFFFAOYSA-N
SMILES:C(N1CCC2(CC1)OCCO2)C3=CC(C(=O)C4=C(F)C=C(Br)C=C4)=CC=C3
Synonyms:- Methanone, (4-bromo-2-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
- (4-Bromo-2-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.