CymitQuimica logo

CAS 898762-12-4

:

3-(3-chlorophenyl)-1-(o-tolyl)propan-1-one

Description:
3-(3-Chlorophenyl)-1-(o-tolyl)propan-1-one, identified by its CAS number 898762-12-4, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two distinct aromatic substituents: a 3-chlorophenyl group and an o-tolyl group. The presence of the chlorine atom on the phenyl ring can influence the compound's reactivity and physical properties, such as its boiling point and solubility. This compound is typically characterized by its molecular structure, which includes a carbonyl group (C=O) that is central to its ketone classification. The aromatic rings contribute to its stability and can affect its interactions in various chemical environments. Additionally, due to the presence of multiple functional groups, it may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its synthesis and applications may be explored in organic chemistry, particularly in the development of new materials or drugs.
Formula:C16H15ClO
InChI:InChI=1/C16H15ClO/c1-12-5-2-3-8-15(12)16(18)10-9-13-6-4-7-14(17)11-13/h2-8,11H,9-10H2,1H3
SMILES:Cc1ccccc1C(=O)CCc1cccc(c1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.