CAS 898762-16-8

Methanone, (4-chloro-2-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (4-chloro-2-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its chemical reactivity and potential biological activity. The compound also features a spirocyclic structure, which can influence its conformational properties and interactions with biological targets. Its molecular formula and specific arrangement of atoms suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the dioxa and azaspiro moieties may enhance its solubility and bioavailability. As with many synthetic organic compounds, the physical properties such as melting point, boiling point, and solubility would need to be determined experimentally. Safety and handling considerations are essential, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.

Formula: C₂₁H₂₁ClFNO₃

InChI: InChI=1S/C21H21ClFNO3/c22-17-4-5-18(19(23)13-17)20(25)16-3-1-2-15(12-16)14-24-8-6-21(7-9-24)26-10-11-27-21/h1-5,12-13H,6-11,14H2

InChI key: InChIKey=VBRCNPXIRIDCBH-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC(C(=O)C4=C(F)C=C(Cl)C=C4)=CC=C3

Synonyms:

• (4-Chloro-2-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
• Methanone, (4-chloro-2-fluorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

4-chloro-3′-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]-2-fluorobenzophenone

CAS: 898762-16-8

Formula: C₂₁H₂₁ClFNO₃

Purity: 97.0%

Molecular weight: 389.85

Ref: 10-F204921