CAS 898762-19-1

Methanone, (2,3-dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (2,3-dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, including a methanone functional group and a spirocyclic structure. The presence of dichlorophenyl and phenyl groups indicates potential aromatic characteristics, contributing to its stability and reactivity. The compound also contains a dioxane moiety, which may enhance solubility in polar solvents and influence its interaction with biological systems. The spirocyclic structure suggests potential for conformational diversity, which can affect its biological activity and pharmacokinetics. Additionally, the presence of chlorine substituents may impart specific electronic properties, influencing the compound's reactivity and potential applications in medicinal chemistry. Overall, this compound's intricate structure suggests it may possess interesting properties for research, particularly in the fields of drug development and material science. However, detailed studies would be necessary to fully elucidate its characteristics and potential applications.

Formula: C₂₁H₂₁Cl₂NO₃

InChI: InChI=1S/C21H21Cl2NO3/c22-18-6-2-5-17(19(18)23)20(25)16-4-1-3-15(13-16)14-24-9-7-21(8-10-24)26-11-12-27-21/h1-6,13H,7-12,14H2

InChI key: InChIKey=BEBDLOSGMCFJKL-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC(C(=O)C4=C(Cl)C(Cl)=CC=C4)=CC=C3

Synonyms:

• Methanone, (2,3-dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
• (2,3-Dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone