CAS 898762-20-4

3-(3-chlorophenyl)-1-(2-methoxyphenyl)propan-1-one

Description:

3-(3-Chlorophenyl)-1-(2-methoxyphenyl)propan-1-one, identified by its CAS number 898762-20-4, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two aromatic substituents: a 3-chlorophenyl group and a 2-methoxyphenyl group. The presence of the chlorine atom introduces a degree of electron-withdrawing character, which can influence the compound's reactivity and stability. The methoxy group, on the other hand, is an electron-donating substituent that can enhance the compound's nucleophilicity. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, its physical properties such as solubility, melting point, and boiling point would depend on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₆H₁₅ClO₂

InChI: InChI=1/C16H15ClO2/c1-19-16-8-3-2-7-14(16)15(18)10-9-12-5-4-6-13(17)11-12/h2-8,11H,9-10H2,1H3

SMILES: COc1ccccc1C(=O)CCc1cccc(c1)Cl