CAS 898762-22-6

Methanone, (2,4-dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (2,4-dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, including a methanone functional group and a spirocyclic structure. The presence of dichlorophenyl groups indicates that the compound has two chlorine atoms substituted on a phenyl ring, which can influence its reactivity and biological activity. The spirocyclic moiety, specifically the 1,4-dioxa-8-azaspiro structure, contributes to the compound's three-dimensional conformation, potentially affecting its interaction with biological targets. This compound may exhibit specific pharmacological properties due to its intricate structure, making it of interest in medicinal chemistry. Additionally, the presence of both aromatic and heterocyclic components suggests potential applications in drug development or as a synthetic intermediate. As with many organic compounds, its solubility, stability, and reactivity will depend on the surrounding conditions, including solvent and temperature. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₂₁H₂₁Cl₂NO₃

InChI: InChI=1S/C21H21Cl2NO3/c22-17-4-5-18(19(23)13-17)20(25)16-3-1-2-15(12-16)14-24-8-6-21(7-9-24)26-10-11-27-21/h1-5,12-13H,6-11,14H2

InChI key: InChIKey=YBMLPWLXOYGIIL-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC(C(=O)C4=C(Cl)C=C(Cl)C=C4)=CC=C3

Synonyms:

• Methanone, (2,4-dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
• (2,4-Dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone