CAS 898762-25-9
:Methanone, (2,5-dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
Description:
Methanone, (2,5-dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, including a methanone functional group and a spirocyclic moiety. The presence of dichlorophenyl groups indicates that the compound has two chlorine substituents on the phenyl ring, which can influence its reactivity and physical properties, such as solubility and boiling point. The spirocyclic structure contributes to the compound's three-dimensional conformation, potentially affecting its biological activity and interactions with other molecules. Additionally, the inclusion of a dioxane ring suggests the presence of ether functionalities, which may enhance solubility in organic solvents. This compound may exhibit interesting pharmacological properties due to its complex structure, making it a subject of interest in medicinal chemistry. However, specific details regarding its stability, reactivity, and potential applications would require further investigation through experimental studies and literature review.
Formula:C21H21Cl2NO3
InChI:InChI=1S/C21H21Cl2NO3/c22-17-4-5-19(23)18(13-17)20(25)16-3-1-2-15(12-16)14-24-8-6-21(7-9-24)26-10-11-27-21/h1-5,12-13H,6-11,14H2
InChI key:InChIKey=YEJWUWRFEPYAGM-UHFFFAOYSA-N
SMILES:C(N1CCC2(CC1)OCCO2)C3=CC(C(=O)C4=C(Cl)C=CC(Cl)=C4)=CC=C3
Synonyms:- Methanone, (2,5-dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
- (2,5-Dichlorophenyl)[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.