CAS 898762-27-1

Methanone, (4-chloro-2-fluorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (4-chloro-2-fluorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a piperazine moiety suggests potential biological activity, as piperazines are often found in pharmaceuticals and can interact with various biological targets. The chlorine and fluorine substituents on the phenyl rings may influence the compound's lipophilicity, stability, and reactivity, potentially enhancing its pharmacological properties. This compound is likely to exhibit moderate to high solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic components. Additionally, the presence of multiple functional groups may allow for various chemical reactions, making it a candidate for further synthetic modifications. Overall, the unique combination of substituents and functional groups in this compound suggests it may have applications in medicinal chemistry or as a research tool in studying biological systems.

Formula: C₁₉H₂₀ClFN₂O

InChI: InChI=1S/C19H20ClFN2O/c1-22-8-10-23(11-9-22)13-14-4-2-3-5-16(14)19(24)17-7-6-15(20)12-18(17)21/h2-7,12H,8-11,13H2,1H3

InChI key: InChIKey=RLVSCAYNECOQSB-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(F)C=C(Cl)C=C2)C=CC=C1)N3CCN(C)CC3

Synonyms:

• (4-Chloro-2-fluorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• 4-Chloro-2-fluoro-2′-(4-methylpiperazinomethyl) benzophenone
• Methanone, (4-chloro-2-fluorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

4-chloro-2-fluoro-2′-(4-methylpiperazinomethyl) benzophenone

CAS: 898762-27-1

Formula: C₁₉H₂₀ClFN₂O

Purity: 97.0%

Molecular weight: 346.83

Ref: 10-F205489