CAS 898762-36-2

Methanone, (2,5-dichlorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (2,5-dichlorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl and piperazinyl moieties suggests that it may exhibit significant biological activity, potentially interacting with various biological targets. The compound is likely to be a solid at room temperature, given its structural characteristics, and may have moderate solubility in organic solvents. Its molecular structure indicates potential for hydrogen bonding due to the piperazine ring, which could influence its pharmacokinetic properties. Additionally, the presence of chlorine substituents may affect its reactivity and stability. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards. Overall, this compound's unique features make it of interest in medicinal chemistry and related fields, although specific applications would depend on further research and characterization.

Formula: C₁₉H₂₀Cl₂N₂O

InChI: InChI=1S/C19H20Cl2N2O/c1-22-8-10-23(11-9-22)13-14-4-2-3-5-16(14)19(24)17-12-15(20)6-7-18(17)21/h2-7,12H,8-11,13H2,1H3

InChI key: InChIKey=PGYXSCHPVLANDS-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(Cl)C=CC(Cl)=C2)C=CC=C1)N3CCN(C)CC3

Synonyms:

• Methanone, (2,5-dichlorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• (2,5-Dichlorophenyl)[2-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone

2,5-dichloro-2′-(4-methylpiperazinomethyl) benzophenone

CAS: 898762-36-2

Formula: C₁₉H₂₀Cl₂N₂O

Purity: 97.0%

Molecular weight: 363.28

Ref: 10-F205492