CAS 898762-39-5
:(3,4-dichlorophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone
Description:
The chemical substance known as (3,4-dichlorophenyl)-[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898762-39-5, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a piperazine moiety. This compound typically exhibits properties associated with its functional groups, such as potential biological activity due to the presence of the piperazine ring, which is often linked to pharmacological effects. The dichlorophenyl group may enhance lipophilicity, influencing the compound's solubility and permeability. In terms of physical properties, it may be a solid at room temperature, with a specific melting point and solubility profile depending on the solvent used. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. As with many synthetic compounds, safety and handling precautions are essential, and its behavior in biological systems would require thorough investigation through pharmacokinetic and toxicological studies.
Formula:C19H20Cl2N2O
InChI:InChI=1/C19H20Cl2N2O/c1-22-8-10-23(11-9-22)13-15-4-2-3-5-16(15)19(24)14-6-7-17(20)18(21)12-14/h2-7,12H,8-11,13H2,1H3
SMILES:CN1CCN(CC1)Cc1ccccc1C(=O)c1ccc(c(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.