CAS 898762-46-4

Methanone, cyclopropyl[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, cyclopropyl[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, including a cyclopropyl group and a spirocyclic moiety. The presence of the 1,4-dioxa and azaspiro components suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological targets. This compound may exhibit specific physical and chemical properties such as solubility in organic solvents, stability under various conditions, and potential reactivity with nucleophiles or electrophiles. Its molecular structure likely contributes to its biological activity, making it a candidate for further research in drug development. Additionally, the compound's CAS number, 898762-46-4, allows for easy identification and retrieval of information in chemical databases. Overall, the characteristics of this compound highlight its potential significance in various chemical and pharmaceutical applications.

Formula: C₁₈H₂₃NO₃

InChI: InChI=1S/C18H23NO3/c20-17(15-4-5-15)16-3-1-2-14(12-16)13-19-8-6-18(7-9-19)21-10-11-22-18/h1-3,12,15H,4-11,13H2

InChI key: InChIKey=URWSHSYKHWUMOI-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC(C(=O)C4CC4)=CC=C3

Synonyms:

• Cyclopropyl[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
• Methanone, cyclopropyl[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

cyclopropyl 3-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]phenyl ketone

CAS: 898762-46-4

Formula: C₁₈H₂₃NO₃

Purity: 97.0%

Molecular weight: 301.386

Ref: 10-F204931