CAS 898762-47-5

3-(3-chlorophenyl)-1-(2-methylsulfanylphenyl)propan-1-one

Description:

3-(3-chlorophenyl)-1-(2-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898762-47-5, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two distinct aromatic substituents: a 3-chlorophenyl group and a 2-methylsulfanylphenyl group. The presence of the chlorine atom introduces electronegative characteristics, potentially influencing the compound's reactivity and polarity. The methylsulfanyl group contributes to the compound's overall hydrophobic nature while also providing potential sites for further chemical modifications. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. As with many organic compounds, its physical properties such as solubility, melting point, and boiling point would depend on the specific interactions between its functional groups and the surrounding environment. Safety data and handling precautions should be consulted due to the presence of chlorine and sulfur in its structure.

Formula: C₁₆H₁₅ClOS

InChI: InChI=1/C16H15ClOS/c1-19-16-8-3-2-7-14(16)15(18)10-9-12-5-4-6-13(17)11-12/h2-8,11H,9-10H2,1H3

SMILES: CSc1ccccc1C(=O)CCc1cccc(c1)Cl